C17H22N4O5S — CID 108564651
2-[2-[4-(dimethylsulfamoylamino)piperidin-1-yl]-2-oxoethyl]-1,3-dioxoisoindole (PubChem CID 108564651) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is 2-[2-[4-(dimethylsulfamoylamino)piperidin-1-yl]-2-oxoethyl]-1,3-dioxoisoindole.
| Compound Name | 2-[2-[4-(dimethylsulfamoylamino)piperidin-1-yl]-2-oxoethyl]-1,3-dioxoisoindole |
|---|---|
| PubChem CID | 108564651 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-[2-[4-(dimethylsulfamoylamino)piperidin-1-yl]-2-oxoethyl]-1,3-dioxoisoindole |
| SMILES | CN(C)S(=O)(=O)NC1CCN(C(=O)CN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C17H22N4O5S/c1-19(2)27(25,26)18-12-7-9-20(10-8-12)15(22)11-21-16(23)13-5-3-4-6-14(13)17(21)24/h3-6,12,18H,7-11H2,1-2H3 |
| InChIKey | TYYHUGMDINUEGE-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|