C17H22ClN3O3 — CID 119519454
2-[2-[4-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]isoindole-1,3-dione;hydrochloride (PubChem CID 119519454) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is 2-[2-[4-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[2-[4-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 119519454 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-[2-[4-(1-aminoethyl)piperidin-1-yl]-2-oxoethyl]isoindole-1,3-dione;hydrochloride |
| SMILES | CC(N)C1CCN(C(=O)CN2C(=O)c3ccccc3C2=O)CC1.Cl |
| InChI | InChI=1S/C17H21N3O3.ClH/c1-11(18)12-6-8-19(9-7-12)15(21)10-20-16(22)13-4-2-3-5-14(13)17(20)23;/h2-5,11-12H,6-10,18H2,1H3;1H |
| InChIKey | BYOJMYYLMNSIQQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|