C32H26N6O10 — CID 71620049
(2S)-2,4-bis[2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]butanoic acid (PubChem CID 71620049) has the molecular formula C32H26N6O10 and a molecular weight of 654.59 g/mol. Its IUPAC name is (2S)-2,4-bis[2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]butanoic acid.
| Compound Name | (2S)-2,4-bis[2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]butanoic acid |
|---|---|
| PubChem CID | 71620049 |
| Molecular Formula | C32H26N6O10 |
| Molecular Weight | 654.59 g/mol |
| Exact Mass | 654.17 |
| IUPAC Name | (2S)-2,4-bis[2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethylamino]butanoic acid |
| SMILES | O=C(O)[C@H](CCNCCN1C(=O)c2cccc3cc([N+](=O)[O-])cc(c23)C1=O)NCCN1C(=O)c2cccc3cc([N+](=O)[O-])cc(c23)C1=O |
| InChI | InChI=1S/C32H26N6O10/c39-28-21-5-1-3-17-13-19(37(45)46)15-23(26(17)21)30(41)35(28)11-9-33-8-7-25(32(43)44)34-10-12-36-29(40)22-6-2-4-18-14-20(38(47)48)16-24(27(18)22)31(36)42/h1-6,13-16,25,33-34H,7-12H2,(H,43,44)/t25-/m0/s1 |
| InChIKey | JWDVEPHLAINBOP-VWLOTQADSA-N |
| XLogP | 2.72 |
| TPSA | 222.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|