C19H19N3O8 — CID 178103749
N-hydroxy-3-[2-[2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethoxy]ethoxy]propanamide (PubChem CID 178103749) has the molecular formula C19H19N3O8 and a molecular weight of 417.37 g/mol. Its IUPAC name is N-hydroxy-3-[2-[2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethoxy]ethoxy]propanamide.
| Compound Name | N-hydroxy-3-[2-[2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 178103749 |
| Molecular Formula | C19H19N3O8 |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-hydroxy-3-[2-[2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethoxy]ethoxy]propanamide |
| SMILES | O=C(CCOCCOCCN1C(=O)c2cccc3cc([N+](=O)[O-])cc(c23)C1=O)NO |
| InChI | InChI=1S/C19H19N3O8/c23-16(20-26)4-6-29-8-9-30-7-5-21-18(24)14-3-1-2-12-10-13(22(27)28)11-15(17(12)14)19(21)25/h1-3,10-11,26H,4-9H2,(H,20,23) |
| InChIKey | FRJUYUUJZGWXHN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|