C20H11Cl3N2O7S — CID 100820139
2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl 2,4,5-trichlorobenzenesulfonate (PubChem CID 100820139) has the molecular formula C20H11Cl3N2O7S and a molecular weight of 529.74 g/mol. Its IUPAC name is 2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl 2,4,5-trichlorobenzenesulfonate.
| Compound Name | 2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl 2,4,5-trichlorobenzenesulfonate |
|---|---|
| PubChem CID | 100820139 |
| Molecular Formula | C20H11Cl3N2O7S |
| Molecular Weight | 529.74 g/mol |
| Exact Mass | 527.94 |
| IUPAC Name | 2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl 2,4,5-trichlorobenzenesulfonate |
| SMILES | O=C1c2cccc3cc([N+](=O)[O-])cc(c23)C(=O)N1CCOS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H11Cl3N2O7S/c21-14-8-16(23)17(9-15(14)22)33(30,31)32-5-4-24-19(26)12-3-1-2-10-6-11(25(28)29)7-13(18(10)12)20(24)27/h1-3,6-9H,4-5H2 |
| InChIKey | RXBBYFUTJLFSBJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.74 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|