C24H20N4O8S — CID 3809807
N-[4-[acetyl(methyl)amino]phenyl]-N-methylsulfonyl-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)acetamide (PubChem CID 3809807) has the molecular formula C24H20N4O8S and a molecular weight of 524.51 g/mol. Its IUPAC name is N-[4-[acetyl(methyl)amino]phenyl]-N-methylsulfonyl-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)acetamide.
| Compound Name | N-[4-[acetyl(methyl)amino]phenyl]-N-methylsulfonyl-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)acetamide |
|---|---|
| PubChem CID | 3809807 |
| Molecular Formula | C24H20N4O8S |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | N-[4-[acetyl(methyl)amino]phenyl]-N-methylsulfonyl-2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)acetamide |
| SMILES | CC(=O)N(C)c1ccc(N(C(=O)CN2C(=O)c3cccc4cc([N+](=O)[O-])cc(c34)C2=O)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H20N4O8S/c1-14(29)25(2)16-7-9-17(10-8-16)27(37(3,35)36)21(30)13-26-23(31)19-6-4-5-15-11-18(28(33)34)12-20(22(15)19)24(26)32/h4-12H,13H2,1-3H3 |
| InChIKey | FOZNGPFUUNHHMP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 155.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|