C20H13IN2O7S — CID 100820087
2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl 4-iodobenzenesulfonate (PubChem CID 100820087) has the molecular formula C20H13IN2O7S and a molecular weight of 552.30 g/mol. Its IUPAC name is 2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl 4-iodobenzenesulfonate.
| Compound Name | 2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl 4-iodobenzenesulfonate |
|---|---|
| PubChem CID | 100820087 |
| Molecular Formula | C20H13IN2O7S |
| Molecular Weight | 552.30 g/mol |
| Exact Mass | 551.95 |
| IUPAC Name | 2-(5-nitro-1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl 4-iodobenzenesulfonate |
| SMILES | O=C1c2cccc3cc([N+](=O)[O-])cc(c23)C(=O)N1CCOS(=O)(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C20H13IN2O7S/c21-13-4-6-15(7-5-13)31(28,29)30-9-8-22-19(24)16-3-1-2-12-10-14(23(26)27)11-17(18(12)16)20(22)25/h1-7,10-11H,8-9H2 |
| InChIKey | JPHGHSZZDHKXHB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|