C11H12BrN2O5S- — CID 173317255
2-(4-bromobutyl)-1-hydroxy-5-nitro-1-oxido-1,2-benzothiazol-3-one (PubChem CID 173317255) has the molecular formula C11H12BrN2O5S- and a molecular weight of 364.20 g/mol. Its IUPAC name is 2-(4-bromobutyl)-1-hydroxy-5-nitro-1-oxido-1,2-benzothiazol-3-one.
| Compound Name | 2-(4-bromobutyl)-1-hydroxy-5-nitro-1-oxido-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 173317255 |
| Molecular Formula | C11H12BrN2O5S- |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 2-(4-bromobutyl)-1-hydroxy-5-nitro-1-oxido-1,2-benzothiazol-3-one |
| SMILES | O=C1c2cc([N+](=O)[O-])ccc2S([O-])(O)N1CCCCBr |
| InChI | InChI=1S/C11H13BrN2O5S/c12-5-1-2-6-13-11(15)9-7-8(14(16)17)3-4-10(9)20(13,18)19/h3-4,7,18-19H,1-2,5-6H2/p-1 |
| InChIKey | JUMVZIHVJZEDHV-UHFFFAOYSA-M |
| XLogP | 2.91 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|