C11H13BrN2O5S — CID 67657602
2-(4-bromobutyl)-1,1-dihydroxy-7-nitro-1,2-benzothiazol-3-one (PubChem CID 67657602) has the molecular formula C11H13BrN2O5S and a molecular weight of 365.21 g/mol. Its IUPAC name is 2-(4-bromobutyl)-1,1-dihydroxy-7-nitro-1,2-benzothiazol-3-one.
| Compound Name | 2-(4-bromobutyl)-1,1-dihydroxy-7-nitro-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 67657602 |
| Molecular Formula | C11H13BrN2O5S |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 363.97 |
| IUPAC Name | 2-(4-bromobutyl)-1,1-dihydroxy-7-nitro-1,2-benzothiazol-3-one |
| SMILES | O=C1c2cccc([N+](=O)[O-])c2S(O)(O)N1CCCCBr |
| InChI | InChI=1S/C11H13BrN2O5S/c12-6-1-2-7-13-11(15)8-4-3-5-9(14(16)17)10(8)20(13,18)19/h3-5,18-19H,1-2,6-7H2 |
| InChIKey | ZWMXBIITWKUYHG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 103.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|