C21H23N3O6S — CID 122186715
N-hydroxy-4-[[6-(1,1,3-trioxo-1,2-benzothiazol-2-yl)hexanoylamino]methyl]benzamide (PubChem CID 122186715) has the molecular formula C21H23N3O6S and a molecular weight of 445.50 g/mol. Its IUPAC name is N-hydroxy-4-[[6-(1,1,3-trioxo-1,2-benzothiazol-2-yl)hexanoylamino]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[6-(1,1,3-trioxo-1,2-benzothiazol-2-yl)hexanoylamino]methyl]benzamide |
|---|---|
| PubChem CID | 122186715 |
| Molecular Formula | C21H23N3O6S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | N-hydroxy-4-[[6-(1,1,3-trioxo-1,2-benzothiazol-2-yl)hexanoylamino]methyl]benzamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2S1(=O)=O)NCc1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C21H23N3O6S/c25-19(22-14-15-9-11-16(12-10-15)20(26)23-28)8-2-1-5-13-24-21(27)17-6-3-4-7-18(17)31(24,29)30/h3-4,6-7,9-12,28H,1-2,5,8,13-14H2,(H,22,25)(H,23,26) |
| InChIKey | RNLTXLBZJKKYNB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|