C22H21N3O5S — CID 155556307
N-(8-hydroxyquinolin-5-yl)-6-(1,1,3-trioxo-1,2-benzothiazol-2-yl)hexanamide (PubChem CID 155556307) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is N-(8-hydroxyquinolin-5-yl)-6-(1,1,3-trioxo-1,2-benzothiazol-2-yl)hexanamide.
| Compound Name | N-(8-hydroxyquinolin-5-yl)-6-(1,1,3-trioxo-1,2-benzothiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 155556307 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-(8-hydroxyquinolin-5-yl)-6-(1,1,3-trioxo-1,2-benzothiazol-2-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)c2ccccc2S1(=O)=O)Nc1ccc(O)c2ncccc12 |
| InChI | InChI=1S/C22H21N3O5S/c26-18-12-11-17(15-8-6-13-23-21(15)18)24-20(27)10-2-1-5-14-25-22(28)16-7-3-4-9-19(16)31(25,29)30/h3-4,6-9,11-13,26H,1-2,5,10,14H2,(H,24,27) |
| InChIKey | FHUWHICQBYOHBL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|