C18H19N3O5S — CID 119072889
N-[3-(2-oxo-1-pyridinyl)propyl]-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanamide (PubChem CID 119072889) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is N-[3-(2-oxo-1-pyridinyl)propyl]-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanamide.
| Compound Name | N-[3-(2-oxo-1-pyridinyl)propyl]-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 119072889 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-[3-(2-oxo-1-pyridinyl)propyl]-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2S1(=O)=O)NCCCn1ccccc1=O |
| InChI | InChI=1S/C18H19N3O5S/c22-16(19-10-5-12-20-11-4-3-8-17(20)23)9-13-21-18(24)14-6-1-2-7-15(14)27(21,25)26/h1-4,6-8,11H,5,9-10,12-13H2,(H,19,22) |
| InChIKey | LJTPGTBAVHIBJD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|