C18H21ClN2O2S — CID 86855668
3-(4-chlorophenyl)sulfanyl-N-[4-(2-oxo-1-pyridinyl)butyl]propanamide (PubChem CID 86855668) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N-[4-(2-oxo-1-pyridinyl)butyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N-[4-(2-oxo-1-pyridinyl)butyl]propanamide |
|---|---|
| PubChem CID | 86855668 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N-[4-(2-oxo-1-pyridinyl)butyl]propanamide |
| SMILES | O=C(CCSc1ccc(Cl)cc1)NCCCCn1ccccc1=O |
| InChI | InChI=1S/C18H21ClN2O2S/c19-15-6-8-16(9-7-15)24-14-10-17(22)20-11-2-4-13-21-12-3-1-5-18(21)23/h1,3,5-9,12H,2,4,10-11,13-14H2,(H,20,22) |
| InChIKey | HNOODDJZDINWTQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|