C18H18Cl3NOS2 — CID 126035220
3-(4-chlorophenyl)sulfanyl-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]propanamide (PubChem CID 126035220) has the molecular formula C18H18Cl3NOS2 and a molecular weight of 434.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 126035220 |
| Molecular Formula | C18H18Cl3NOS2 |
| Molecular Weight | 434.84 g/mol |
| Exact Mass | 432.99 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N-[2-[(2,6-dichlorophenyl)methylsulfanyl]ethyl]propanamide |
| SMILES | O=C(CCSc1ccc(Cl)cc1)NCCSCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H18Cl3NOS2/c19-13-4-6-14(7-5-13)25-10-8-18(23)22-9-11-24-12-15-16(20)2-1-3-17(15)21/h1-7H,8-12H2,(H,22,23) |
| InChIKey | SNCUMLHHDAYHSI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.84 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|