C19H19ClFNO2S — CID 26635879
4-(4-chlorophenyl)-N-[3-(4-fluorophenyl)sulfanylpropyl]-4-oxobutanamide (PubChem CID 26635879) has the molecular formula C19H19ClFNO2S and a molecular weight of 379.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[3-(4-fluorophenyl)sulfanylpropyl]-4-oxobutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[3-(4-fluorophenyl)sulfanylpropyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 26635879 |
| Molecular Formula | C19H19ClFNO2S |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[3-(4-fluorophenyl)sulfanylpropyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)cc1)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C19H19ClFNO2S/c20-15-4-2-14(3-5-15)18(23)10-11-19(24)22-12-1-13-25-17-8-6-16(21)7-9-17/h2-9H,1,10-13H2,(H,22,24) |
| InChIKey | OZNQVCARPXKKIX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|