C14H17FN2O3 — CID 108795606
4-(4-fluorophenyl)-N-(3-formamidopropyl)-4-oxobutanamide (PubChem CID 108795606) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(3-formamidopropyl)-4-oxobutanamide.
| Compound Name | 4-(4-fluorophenyl)-N-(3-formamidopropyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 108795606 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(3-formamidopropyl)-4-oxobutanamide |
| SMILES | O=CNCCCNC(=O)CCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H17FN2O3/c15-12-4-2-11(3-5-12)13(19)6-7-14(20)17-9-1-8-16-10-18/h2-5,10H,1,6-9H2,(H,16,18)(H,17,20) |
| InChIKey | ARDQLILHNWZESB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|