C17H20N2O7S — CID 7600861
N-[[(2R,5S)-2,5-dimethoxy-2H-furan-5-yl]methyl]-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanamide (PubChem CID 7600861) has the molecular formula C17H20N2O7S and a molecular weight of 396.42 g/mol. Its IUPAC name is N-[[(2R,5S)-2,5-dimethoxy-2H-furan-5-yl]methyl]-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanamide.
| Compound Name | N-[[(2R,5S)-2,5-dimethoxy-2H-furan-5-yl]methyl]-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 7600861 |
| Molecular Formula | C17H20N2O7S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[[(2R,5S)-2,5-dimethoxy-2H-furan-5-yl]methyl]-3-(1,1,3-trioxo-1,2-benzothiazol-2-yl)propanamide |
| SMILES | CO[C@H]1C=C[C@](CNC(=O)CCN2C(=O)c3ccccc3S2(=O)=O)(OC)O1 |
| InChI | InChI=1S/C17H20N2O7S/c1-24-15-7-9-17(25-2,26-15)11-18-14(20)8-10-19-16(21)12-5-3-4-6-13(12)27(19,22)23/h3-7,9,15H,8,10-11H2,1-2H3,(H,18,20)/t15-,17+/m1/s1 |
| InChIKey | SRRUHJHYMNCLTH-WBVHZDCISA-N |
| XLogP | 0.24 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|