C23H21N5O4S2 — CID 10185155
2-benzyl-N-(1,3-dihydro-2,1,3-benzothiadiazol-5-ylmethyl)-4-methyl-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxamide (PubChem CID 10185155) has the molecular formula C23H21N5O4S2 and a molecular weight of 495.59 g/mol. Its IUPAC name is 2-benzyl-N-(1,3-dihydro-2,1,3-benzothiadiazol-5-ylmethyl)-4-methyl-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxamide.
| Compound Name | 2-benzyl-N-(1,3-dihydro-2,1,3-benzothiadiazol-5-ylmethyl)-4-methyl-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxamide |
|---|---|
| PubChem CID | 10185155 |
| Molecular Formula | C23H21N5O4S2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 2-benzyl-N-(1,3-dihydro-2,1,3-benzothiadiazol-5-ylmethyl)-4-methyl-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxamide |
| SMILES | CN1C(=O)N(Cc2ccccc2)S(=O)(=O)c2cc(C(=O)NCc3ccc4c(c3)NSN4)ccc21 |
| InChI | InChI=1S/C23H21N5O4S2/c1-27-20-10-8-17(22(29)24-13-16-7-9-18-19(11-16)26-33-25-18)12-21(20)34(31,32)28(23(27)30)14-15-5-3-2-4-6-15/h2-12,25-26H,13-14H2,1H3,(H,24,29) |
| InChIKey | YIQWDWSFASIGIF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|