C22H21N5O3S — CID 10181426
4-N-(1,3-dihydro-2,1,3-benzothiadiazol-5-ylmethyl)-2-N-[(4-methoxyphenyl)methyl]pyridine-2,4-dicarboxamide (PubChem CID 10181426) has the molecular formula C22H21N5O3S and a molecular weight of 435.51 g/mol. Its IUPAC name is 4-N-(1,3-dihydro-2,1,3-benzothiadiazol-5-ylmethyl)-2-N-[(4-methoxyphenyl)methyl]pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(1,3-dihydro-2,1,3-benzothiadiazol-5-ylmethyl)-2-N-[(4-methoxyphenyl)methyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 10181426 |
| Molecular Formula | C22H21N5O3S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 4-N-(1,3-dihydro-2,1,3-benzothiadiazol-5-ylmethyl)-2-N-[(4-methoxyphenyl)methyl]pyridine-2,4-dicarboxamide |
| SMILES | COc1ccc(CNC(=O)c2cc(C(=O)NCc3ccc4c(c3)NSN4)ccn2)cc1 |
| InChI | InChI=1S/C22H21N5O3S/c1-30-17-5-2-14(3-6-17)12-25-22(29)20-11-16(8-9-23-20)21(28)24-13-15-4-7-18-19(10-15)27-31-26-18/h2-11,26-27H,12-13H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | YRHYBRWOUQTMCS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|