C17H13ClN2O3 — CID 51158730
N-[(3-chlorophenyl)methyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 51158730) has the molecular formula C17H13ClN2O3 and a molecular weight of 328.76 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 51158730 |
| Molecular Formula | C17H13ClN2O3 |
| Molecular Weight | 328.76 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CN1C(=O)c2ccc(C(=O)NCc3cccc(Cl)c3)cc2C1=O |
| InChI | InChI=1S/C17H13ClN2O3/c1-20-16(22)13-6-5-11(8-14(13)17(20)23)15(21)19-9-10-3-2-4-12(18)7-10/h2-8H,9H2,1H3,(H,19,21) |
| InChIKey | ZLZOJQSCDRTICV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.76 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|