C18H17N3O5S — CID 55586968
2-methyl-N-[[4-(methylsulfamoyl)phenyl]methyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55586968) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 2-methyl-N-[[4-(methylsulfamoyl)phenyl]methyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-methyl-N-[[4-(methylsulfamoyl)phenyl]methyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55586968 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 2-methyl-N-[[4-(methylsulfamoyl)phenyl]methyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CNS(=O)(=O)c1ccc(CNC(=O)c2ccc3c(c2)C(=O)N(C)C3=O)cc1 |
| InChI | InChI=1S/C18H17N3O5S/c1-19-27(25,26)13-6-3-11(4-7-13)10-20-16(22)12-5-8-14-15(9-12)18(24)21(2)17(14)23/h3-9,19H,10H2,1-2H3,(H,20,22) |
| InChIKey | FKHWIBUWJWDRTH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|