C18H22N2O3S2 — CID 55909885
4-(ethylsulfanylmethyl)-N-[[4-(methylsulfamoyl)phenyl]methyl]benzamide (PubChem CID 55909885) has the molecular formula C18H22N2O3S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-(ethylsulfanylmethyl)-N-[[4-(methylsulfamoyl)phenyl]methyl]benzamide.
| Compound Name | 4-(ethylsulfanylmethyl)-N-[[4-(methylsulfamoyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55909885 |
| Molecular Formula | C18H22N2O3S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 4-(ethylsulfanylmethyl)-N-[[4-(methylsulfamoyl)phenyl]methyl]benzamide |
| SMILES | CCSCc1ccc(C(=O)NCc2ccc(S(=O)(=O)NC)cc2)cc1 |
| InChI | InChI=1S/C18H22N2O3S2/c1-3-24-13-15-4-8-16(9-5-15)18(21)20-12-14-6-10-17(11-7-14)25(22,23)19-2/h4-11,19H,3,12-13H2,1-2H3,(H,20,21) |
| InChIKey | GJEXRYUYEJZXIL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |