C23H22N2OS — CID 6622632
N,4-dibenzyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide (PubChem CID 6622632) has the molecular formula C23H22N2OS and a molecular weight of 374.51 g/mol. Its IUPAC name is N,4-dibenzyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide.
| Compound Name | N,4-dibenzyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 6622632 |
| Molecular Formula | C23H22N2OS |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N,4-dibenzyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc2c(c1)N(Cc1ccccc1)CCS2 |
| InChI | InChI=1S/C23H22N2OS/c26-23(24-16-18-7-3-1-4-8-18)20-11-12-22-21(15-20)25(13-14-27-22)17-19-9-5-2-6-10-19/h1-12,15H,13-14,16-17H2,(H,24,26) |
| InChIKey | DNUJLUYDJLHMDB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |