C24H27ClN2OS — CID 3270191
4-[(4-chlorophenyl)methyl]-N-[2-(cyclohexen-1-yl)ethyl]-2,3-dihydro-1,4-benzothiazine-6-carboxamide (PubChem CID 3270191) has the molecular formula C24H27ClN2OS and a molecular weight of 427.01 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-N-[2-(cyclohexen-1-yl)ethyl]-2,3-dihydro-1,4-benzothiazine-6-carboxamide.
| Compound Name | 4-[(4-chlorophenyl)methyl]-N-[2-(cyclohexen-1-yl)ethyl]-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 3270191 |
| Molecular Formula | C24H27ClN2OS |
| Molecular Weight | 427.01 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-N-[2-(cyclohexen-1-yl)ethyl]-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccc2c(c1)N(Cc1ccc(Cl)cc1)CCS2 |
| InChI | InChI=1S/C24H27ClN2OS/c25-21-9-6-19(7-10-21)17-27-14-15-29-23-11-8-20(16-22(23)27)24(28)26-13-12-18-4-2-1-3-5-18/h4,6-11,16H,1-3,5,12-15,17H2,(H,26,28) |
| InChIKey | RJYQIFPKSWZHNC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.01 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|