C25H27ClN2OS — CID 22434770
8-chloro-N-[2-(cyclohexen-1-yl)ethyl]-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 22434770) has the molecular formula C25H27ClN2OS and a molecular weight of 439.02 g/mol. Its IUPAC name is 8-chloro-N-[2-(cyclohexen-1-yl)ethyl]-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 8-chloro-N-[2-(cyclohexen-1-yl)ethyl]-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 22434770 |
| Molecular Formula | C25H27ClN2OS |
| Molecular Weight | 439.02 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 8-chloro-N-[2-(cyclohexen-1-yl)ethyl]-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCC1=Nc2cc(C(=O)NCCC3=CCCCC3)ccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H27ClN2OS/c1-2-6-21-20-16-19(26)10-12-23(20)30-24-11-9-18(15-22(24)28-21)25(29)27-14-13-17-7-4-3-5-8-17/h7,9-12,15-16H,2-6,8,13-14H2,1H3,(H,27,29) |
| InChIKey | MTLWHODHHZDJQZ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.02 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|