C27H35N3OS — CID 20851272
8-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 20851272) has the molecular formula C27H35N3OS and a molecular weight of 449.66 g/mol. Its IUPAC name is 8-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 8-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 20851272 |
| Molecular Formula | C27H35N3OS |
| Molecular Weight | 449.66 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 8-methyl-N-[3-(2-methylpiperidin-1-yl)propyl]-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCC1=Nc2cc(C(=O)NCCCN3CCCCC3C)ccc2Sc2ccc(C)cc21 |
| InChI | InChI=1S/C27H35N3OS/c1-4-8-23-22-17-19(2)10-12-25(22)32-26-13-11-21(18-24(26)29-23)27(31)28-14-7-16-30-15-6-5-9-20(30)3/h10-13,17-18,20H,4-9,14-16H2,1-3H3,(H,28,31) |
| InChIKey | KZSDSGQTWWXCQV-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.66 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|