C25H30ClN3OS — CID 92656957
8-chloro-N-[3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]propyl]-6-methylbenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 92656957) has the molecular formula C25H30ClN3OS and a molecular weight of 456.06 g/mol. Its IUPAC name is 8-chloro-N-[3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]propyl]-6-methylbenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 8-chloro-N-[3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]propyl]-6-methylbenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 92656957 |
| Molecular Formula | C25H30ClN3OS |
| Molecular Weight | 456.06 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 8-chloro-N-[3-[(2R,6R)-2,6-dimethylpiperidin-1-yl]propyl]-6-methylbenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CC1=Nc2cc(C(=O)NCCCN3[C@H](C)CCC[C@H]3C)ccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H30ClN3OS/c1-16-6-4-7-17(2)29(16)13-5-12-27-25(30)19-8-10-24-22(14-19)28-18(3)21-15-20(26)9-11-23(21)31-24/h8-11,14-17H,4-7,12-13H2,1-3H3,(H,27,30)/t16-,17-/m1/s1 |
| InChIKey | FSKNGZBLNIYLIQ-IAGOWNOFSA-N |
| XLogP | 6.33 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.06 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|