C23H34N4OS — CID 20889620
N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-piperidin-1-yl-1,3-benzothiazole-6-carboxamide (PubChem CID 20889620) has the molecular formula C23H34N4OS and a molecular weight of 414.62 g/mol. Its IUPAC name is N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-piperidin-1-yl-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-piperidin-1-yl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 20889620 |
| Molecular Formula | C23H34N4OS |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | N-[3-(2,6-dimethylpiperidin-1-yl)propyl]-2-piperidin-1-yl-1,3-benzothiazole-6-carboxamide |
| SMILES | CC1CCCC(C)N1CCCNC(=O)c1ccc2nc(N3CCCCC3)sc2c1 |
| InChI | InChI=1S/C23H34N4OS/c1-17-8-6-9-18(2)27(17)15-7-12-24-22(28)19-10-11-20-21(16-19)29-23(25-20)26-13-4-3-5-14-26/h10-11,16-18H,3-9,12-15H2,1-2H3,(H,24,28) |
| InChIKey | HGWXXIZNTGIZDG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|