C24H36N4O2S — CID 98460153
(3S)-N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-3-carboxamide (PubChem CID 98460153) has the molecular formula C24H36N4O2S and a molecular weight of 444.65 g/mol. Its IUPAC name is (3S)-N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 98460153 |
| Molecular Formula | C24H36N4O2S |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | (3S)-N-[3-[(3S,5S)-3,5-dimethylpiperidin-1-yl]propyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-3-carboxamide |
| SMILES | COc1ccc2nc(N3CCC[C@H](C(=O)NCCCN4C[C@@H](C)C[C@H](C)C4)C3)sc2c1 |
| InChI | InChI=1S/C24H36N4O2S/c1-17-12-18(2)15-27(14-17)10-5-9-25-23(29)19-6-4-11-28(16-19)24-26-21-8-7-20(30-3)13-22(21)31-24/h7-8,13,17-19H,4-6,9-12,14-16H2,1-3H3,(H,25,29)/t17-,18-,19-/m0/s1 |
| InChIKey | CQICWBGTNIQDSJ-FHWLQOOXSA-N |
| XLogP | 4.01 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|