C24H36N4O2S — CID 126478993
N-[3-[cyclohexyl(methyl)amino]propyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-3-carboxamide (PubChem CID 126478993) has the molecular formula C24H36N4O2S and a molecular weight of 444.65 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)amino]propyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | N-[3-[cyclohexyl(methyl)amino]propyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 126478993 |
| Molecular Formula | C24H36N4O2S |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)amino]propyl]-1-(6-methoxy-1,3-benzothiazol-2-yl)piperidine-3-carboxamide |
| SMILES | COc1ccc2nc(N3CCCC(C(=O)NCCCN(C)C4CCCCC4)C3)sc2c1 |
| InChI | InChI=1S/C24H36N4O2S/c1-27(19-9-4-3-5-10-19)14-7-13-25-23(29)18-8-6-15-28(17-18)24-26-21-12-11-20(30-2)16-22(21)31-24/h11-12,16,18-19H,3-10,13-15,17H2,1-2H3,(H,25,29) |
| InChIKey | WDPVYYRTJQPXEW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|