C24H30N4OS — CID 22434672
6-ethyl-N-[3-(4-methylpiperazin-1-yl)propyl]benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 22434672) has the molecular formula C24H30N4OS and a molecular weight of 422.60 g/mol. Its IUPAC name is 6-ethyl-N-[3-(4-methylpiperazin-1-yl)propyl]benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 6-ethyl-N-[3-(4-methylpiperazin-1-yl)propyl]benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 22434672 |
| Molecular Formula | C24H30N4OS |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 6-ethyl-N-[3-(4-methylpiperazin-1-yl)propyl]benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCC1=Nc2cc(C(=O)NCCCN3CCN(C)CC3)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C24H30N4OS/c1-3-20-19-7-4-5-8-22(19)30-23-10-9-18(17-21(23)26-20)24(29)25-11-6-12-28-15-13-27(2)14-16-28/h4-5,7-10,17H,3,6,11-16H2,1-2H3,(H,25,29) |
| InChIKey | RRAMVFRSFGWWME-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|