C28H29N3OS — CID 58872194
N-(3-phenylpropyl)-6-piperidin-1-ylbenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 58872194) has the molecular formula C28H29N3OS and a molecular weight of 455.63 g/mol. Its IUPAC name is N-(3-phenylpropyl)-6-piperidin-1-ylbenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-(3-phenylpropyl)-6-piperidin-1-ylbenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 58872194 |
| Molecular Formula | C28H29N3OS |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-(3-phenylpropyl)-6-piperidin-1-ylbenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1ccc2c(c1)N=C(N1CCCCC1)c1ccccc1S2 |
| InChI | InChI=1S/C28H29N3OS/c32-28(29-17-9-12-21-10-3-1-4-11-21)22-15-16-26-24(20-22)30-27(31-18-7-2-8-19-31)23-13-5-6-14-25(23)33-26/h1,3-6,10-11,13-16,20H,2,7-9,12,17-19H2,(H,29,32) |
| InChIKey | GRCZPJPGWWZFPI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|