C22H18ClN3OS — CID 70997547
N-(2-anilinoethyl)-6-chlorobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 70997547) has the molecular formula C22H18ClN3OS and a molecular weight of 407.93 g/mol. Its IUPAC name is N-(2-anilinoethyl)-6-chlorobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-(2-anilinoethyl)-6-chlorobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 70997547 |
| Molecular Formula | C22H18ClN3OS |
| Molecular Weight | 407.93 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | N-(2-anilinoethyl)-6-chlorobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | O=C(NCCNc1ccccc1)c1ccc2c(c1)N=C(Cl)c1ccccc1S2 |
| InChI | InChI=1S/C22H18ClN3OS/c23-21-17-8-4-5-9-19(17)28-20-11-10-15(14-18(20)26-21)22(27)25-13-12-24-16-6-2-1-3-7-16/h1-11,14,24H,12-13H2,(H,25,27) |
| InChIKey | KCSSYDUZMMCWPH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.93 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|