C18H16ClFN2OS — CID 42641355
N-butyl-6-chloro-8-fluorobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 42641355) has the molecular formula C18H16ClFN2OS and a molecular weight of 362.86 g/mol. Its IUPAC name is N-butyl-6-chloro-8-fluorobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-butyl-6-chloro-8-fluorobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 42641355 |
| Molecular Formula | C18H16ClFN2OS |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N-butyl-6-chloro-8-fluorobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(c1)N=C(Cl)c1cc(F)ccc1S2 |
| InChI | InChI=1S/C18H16ClFN2OS/c1-2-3-8-21-18(23)11-4-6-16-14(9-11)22-17(19)13-10-12(20)5-7-15(13)24-16/h4-7,9-10H,2-3,8H2,1H3,(H,21,23) |
| InChIKey | FIZJGHNUTUHMGU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|