C24H20ClFN2OS — CID 42642496
N-butyl-6-(4-chlorophenyl)-8-fluorobenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 42642496) has the molecular formula C24H20ClFN2OS and a molecular weight of 438.96 g/mol. Its IUPAC name is N-butyl-6-(4-chlorophenyl)-8-fluorobenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-butyl-6-(4-chlorophenyl)-8-fluorobenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 42642496 |
| Molecular Formula | C24H20ClFN2OS |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | N-butyl-6-(4-chlorophenyl)-8-fluorobenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(c1)N=C(c1ccc(Cl)cc1)c1cc(F)ccc1S2 |
| InChI | InChI=1S/C24H20ClFN2OS/c1-2-3-12-27-24(29)16-6-10-22-20(13-16)28-23(15-4-7-17(25)8-5-15)19-14-18(26)9-11-21(19)30-22/h4-11,13-14H,2-3,12H2,1H3,(H,27,29) |
| InChIKey | SJWBBTIORICJLN-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|