C23H28ClN3OS — CID 122174880
N-[3-[butyl(methyl)amino]propyl]-8-chloro-6-methylbenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 122174880) has the molecular formula C23H28ClN3OS and a molecular weight of 430.02 g/mol. Its IUPAC name is N-[3-[butyl(methyl)amino]propyl]-8-chloro-6-methylbenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-[3-[butyl(methyl)amino]propyl]-8-chloro-6-methylbenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 122174880 |
| Molecular Formula | C23H28ClN3OS |
| Molecular Weight | 430.02 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | N-[3-[butyl(methyl)amino]propyl]-8-chloro-6-methylbenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCCN(C)CCCNC(=O)c1ccc2c(c1)N=C(C)c1cc(Cl)ccc1S2 |
| InChI | InChI=1S/C23H28ClN3OS/c1-4-5-12-27(3)13-6-11-25-23(28)17-7-9-22-20(14-17)26-16(2)19-15-18(24)8-10-21(19)29-22/h7-10,14-15H,4-6,11-13H2,1-3H3,(H,25,28) |
| InChIKey | IYNWFNOEIUPTNL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.02 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|