C25H22Cl2N2OS — CID 145482633
N-butyl-9-chloro-6-(4-chloro-2-methylphenyl)benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 145482633) has the molecular formula C25H22Cl2N2OS and a molecular weight of 469.44 g/mol. Its IUPAC name is N-butyl-9-chloro-6-(4-chloro-2-methylphenyl)benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-butyl-9-chloro-6-(4-chloro-2-methylphenyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 145482633 |
| Molecular Formula | C25H22Cl2N2OS |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | N-butyl-9-chloro-6-(4-chloro-2-methylphenyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(c1)N=C(c1ccc(Cl)cc1C)c1ccc(Cl)cc1S2 |
| InChI | InChI=1S/C25H22Cl2N2OS/c1-3-4-11-28-25(30)16-5-10-22-21(13-16)29-24(19-8-6-17(26)12-15(19)2)20-9-7-18(27)14-23(20)31-22/h5-10,12-14H,3-4,11H2,1-2H3,(H,28,30) |
| InChIKey | BJFIAWFWSBNJOG-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|