C23H19F3N2OS2 — CID 42641813
6-(3-methylthiophen-2-yl)-N-(4,4,4-trifluorobutyl)benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 42641813) has the molecular formula C23H19F3N2OS2 and a molecular weight of 460.55 g/mol. Its IUPAC name is 6-(3-methylthiophen-2-yl)-N-(4,4,4-trifluorobutyl)benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 6-(3-methylthiophen-2-yl)-N-(4,4,4-trifluorobutyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 42641813 |
| Molecular Formula | C23H19F3N2OS2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 6-(3-methylthiophen-2-yl)-N-(4,4,4-trifluorobutyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | Cc1ccsc1C1=Nc2cc(C(=O)NCCCC(F)(F)F)ccc2Sc2ccccc21 |
| InChI | InChI=1S/C23H19F3N2OS2/c1-14-9-12-30-21(14)20-16-5-2-3-6-18(16)31-19-8-7-15(13-17(19)28-20)22(29)27-11-4-10-23(24,25)26/h2-3,5-9,12-13H,4,10-11H2,1H3,(H,27,29) |
| InChIKey | RRJMXUCSGIAFRT-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|