C24H19ClF4N2OS — CID 143817437
6-(4-chloro-2-fluorocyclohexa-1,5-dien-1-yl)-N-(4,4,4-trifluorobutyl)benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 143817437) has the molecular formula C24H19ClF4N2OS and a molecular weight of 494.94 g/mol. Its IUPAC name is 6-(4-chloro-2-fluorocyclohexa-1,5-dien-1-yl)-N-(4,4,4-trifluorobutyl)benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | 6-(4-chloro-2-fluorocyclohexa-1,5-dien-1-yl)-N-(4,4,4-trifluorobutyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 143817437 |
| Molecular Formula | C24H19ClF4N2OS |
| Molecular Weight | 494.94 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | 6-(4-chloro-2-fluorocyclohexa-1,5-dien-1-yl)-N-(4,4,4-trifluorobutyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | O=C(NCCCC(F)(F)F)c1ccc2c(c1)N=C(C1=C(F)CC(Cl)C=C1)c1ccccc1S2 |
| InChI | InChI=1S/C24H19ClF4N2OS/c25-15-7-8-16(18(26)13-15)22-17-4-1-2-5-20(17)33-21-9-6-14(12-19(21)31-22)23(32)30-11-3-10-24(27,28)29/h1-2,4-9,12,15H,3,10-11,13H2,(H,30,32) |
| InChIKey | OSJAOCGKNGKGEA-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.94 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|