C23H20ClN3OS — CID 58872203
N-butyl-6-(5-chloro-2-pyridinyl)benzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 58872203) has the molecular formula C23H20ClN3OS and a molecular weight of 421.95 g/mol. Its IUPAC name is N-butyl-6-(5-chloro-2-pyridinyl)benzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-butyl-6-(5-chloro-2-pyridinyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 58872203 |
| Molecular Formula | C23H20ClN3OS |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-butyl-6-(5-chloro-2-pyridinyl)benzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCCNC(=O)c1ccc2c(c1)N=C(c1ccc(Cl)cn1)c1ccccc1S2 |
| InChI | InChI=1S/C23H20ClN3OS/c1-2-3-12-25-23(28)15-8-11-21-19(13-15)27-22(18-10-9-16(24)14-26-18)17-6-4-5-7-20(17)29-21/h4-11,13-14H,2-3,12H2,1H3,(H,25,28) |
| InChIKey | BJPAADFERYFJAE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|