C28H37N3OS — CID 20851275
N-[3-[cyclohexyl(methyl)amino]propyl]-8-methyl-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide (PubChem CID 20851275) has the molecular formula C28H37N3OS and a molecular weight of 463.69 g/mol. Its IUPAC name is N-[3-[cyclohexyl(methyl)amino]propyl]-8-methyl-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide.
| Compound Name | N-[3-[cyclohexyl(methyl)amino]propyl]-8-methyl-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide |
|---|---|
| PubChem CID | 20851275 |
| Molecular Formula | C28H37N3OS |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | N-[3-[cyclohexyl(methyl)amino]propyl]-8-methyl-6-propylbenzo[b][1,4]benzothiazepine-3-carboxamide |
| SMILES | CCCC1=Nc2cc(C(=O)NCCCN(C)C3CCCCC3)ccc2Sc2ccc(C)cc21 |
| InChI | InChI=1S/C28H37N3OS/c1-4-9-24-23-18-20(2)12-14-26(23)33-27-15-13-21(19-25(27)30-24)28(32)29-16-8-17-31(3)22-10-6-5-7-11-22/h12-15,18-19,22H,4-11,16-17H2,1-3H3,(H,29,32) |
| InChIKey | KTQRDKDKTGRXOL-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|