C21H24N2OS — CID 20876228
4-benzyl-N-cyclopentyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide (PubChem CID 20876228) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is 4-benzyl-N-cyclopentyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide.
| Compound Name | 4-benzyl-N-cyclopentyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 20876228 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 4-benzyl-N-cyclopentyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
| SMILES | O=C(NC1CCCC1)c1ccc2c(c1)N(Cc1ccccc1)CCS2 |
| InChI | InChI=1S/C21H24N2OS/c24-21(22-18-8-4-5-9-18)17-10-11-20-19(14-17)23(12-13-25-20)15-16-6-2-1-3-7-16/h1-3,6-7,10-11,14,18H,4-5,8-9,12-13,15H2,(H,22,24) |
| InChIKey | BYXXTGCOSOYREY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |