C24H24N2OS — CID 20876233
4-benzyl-N-(1-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide (PubChem CID 20876233) has the molecular formula C24H24N2OS and a molecular weight of 388.54 g/mol. Its IUPAC name is 4-benzyl-N-(1-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide.
| Compound Name | 4-benzyl-N-(1-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 20876233 |
| Molecular Formula | C24H24N2OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 4-benzyl-N-(1-phenylethyl)-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
| SMILES | CC(NC(=O)c1ccc2c(c1)N(Cc1ccccc1)CCS2)c1ccccc1 |
| InChI | InChI=1S/C24H24N2OS/c1-18(20-10-6-3-7-11-20)25-24(27)21-12-13-23-22(16-21)26(14-15-28-23)17-19-8-4-2-5-9-19/h2-13,16,18H,14-15,17H2,1H3,(H,25,27) |
| InChIKey | LFUCKUNRGKIGLC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |