C16H15N3O5S — CID 90783130
2-[(4-aminophenyl)methyl]-4-methyl-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxylic acid (PubChem CID 90783130) has the molecular formula C16H15N3O5S and a molecular weight of 361.38 g/mol. Its IUPAC name is 2-[(4-aminophenyl)methyl]-4-methyl-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxylic acid.
| Compound Name | 2-[(4-aminophenyl)methyl]-4-methyl-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxylic acid |
|---|---|
| PubChem CID | 90783130 |
| Molecular Formula | C16H15N3O5S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-[(4-aminophenyl)methyl]-4-methyl-1,1,3-trioxo-1λ6,2,4-benzothiadiazine-7-carboxylic acid |
| SMILES | CN1C(=O)N(Cc2ccc(N)cc2)S(=O)(=O)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C16H15N3O5S/c1-18-13-7-4-11(15(20)21)8-14(13)25(23,24)19(16(18)22)9-10-2-5-12(17)6-3-10/h2-8H,9,17H2,1H3,(H,20,21) |
| InChIKey | KWIAFFDRQHFQKH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|