C11H12N2O3S — CID 107900543
5-amino-2-[(E)-but-2-enyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 107900543) has the molecular formula C11H12N2O3S and a molecular weight of 252.30 g/mol. Its IUPAC name is 5-amino-2-[(E)-but-2-enyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 5-amino-2-[(E)-but-2-enyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 107900543 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 5-amino-2-[(E)-but-2-enyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | C/C=C/CN1C(=O)c2cc(N)ccc2S1(=O)=O |
| InChI | InChI=1S/C11H12N2O3S/c1-2-3-6-13-11(14)9-7-8(12)4-5-10(9)17(13,15)16/h2-5,7H,6,12H2,1H3/b3-2+ |
| InChIKey | NSESOVHUZYWABA-NSCUHMNNSA-N |
| XLogP | 0.99 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|