C11H14N2O3S — CID 117003863
5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 117003863) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 117003863 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CC(C)(C)N1C(=O)c2cc(N)ccc2S1(=O)=O |
| InChI | InChI=1S/C11H14N2O3S/c1-11(2,3)13-10(14)8-6-7(12)4-5-9(8)17(13,15)16/h4-6H,12H2,1-3H3 |
| InChIKey | QXVJHOAARRKFHU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|