About 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one
5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 117003863) has the molecular formula C11H14N2O3S
and a molecular weight of 254.31 g/mol. Its IUPAC name is 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one |
| PubChem CID | 117003863 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CC(C)(C)N1C(=O)c2cc(N)ccc2S1(=O)=O |
| InChI | InChI=1S/C11H14N2O3S/c1-11(2,3)13-10(14)8-6-7(12)4-5-9(8)17(13,15)16/h4-6H,12H2,1-3H3 |
| InChIKey | QXVJHOAARRKFHU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one?
The IUPAC name of 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one (CID 117003863) is 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one?
The canonical SMILES for 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one is CC(C)(C)N1C(=O)c2cc(N)ccc2S1(=O)=O.
What is the InChIKey of 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one?
The InChIKey is QXVJHOAARRKFHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O3S/c1-11(2,3)13-10(14)8-6-7(12)4-5-9(8)17(13,15)16/h4-6H,12H2,1-3H3.
What are the key properties of 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one?
5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one has a molecular weight of 254.31 g/mol, XLogP of 1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-tert-butyl-1,1-dioxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 117003863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).