C16H15NO3S — CID 101062960
1,1-dioxo-2-(2-phenylpropan-2-yl)-1,2-benzothiazol-3-one (PubChem CID 101062960) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 1,1-dioxo-2-(2-phenylpropan-2-yl)-1,2-benzothiazol-3-one.
| Compound Name | 1,1-dioxo-2-(2-phenylpropan-2-yl)-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 101062960 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 1,1-dioxo-2-(2-phenylpropan-2-yl)-1,2-benzothiazol-3-one |
| SMILES | CC(C)(c1ccccc1)N1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C16H15NO3S/c1-16(2,12-8-4-3-5-9-12)17-15(18)13-10-6-7-11-14(13)21(17,19)20/h3-11H,1-2H3 |
| InChIKey | HOJCZSUULNXREG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |