C13H9NO2S2 — CID 134612954
1-oxo-2-phenyl-1-sulfanylidene-1,2-benzothiazol-3-one (PubChem CID 134612954) has the molecular formula C13H9NO2S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-oxo-2-phenyl-1-sulfanylidene-1,2-benzothiazol-3-one.
| Compound Name | 1-oxo-2-phenyl-1-sulfanylidene-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 134612954 |
| Molecular Formula | C13H9NO2S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1-oxo-2-phenyl-1-sulfanylidene-1,2-benzothiazol-3-one |
| SMILES | O=C1c2ccccc2S(=O)(=S)N1c1ccccc1 |
| InChI | InChI=1S/C13H9NO2S2/c15-13-11-8-4-5-9-12(11)18(16,17)14(13)10-6-2-1-3-7-10/h1-9H |
| InChIKey | PBLCINWUOADHAN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |