C13H8BrNO3S — CID 117003940
4-bromo-1,1-dioxo-2-phenyl-1,2-benzothiazol-3-one (PubChem CID 117003940) has the molecular formula C13H8BrNO3S and a molecular weight of 338.18 g/mol. Its IUPAC name is 4-bromo-1,1-dioxo-2-phenyl-1,2-benzothiazol-3-one.
| Compound Name | 4-bromo-1,1-dioxo-2-phenyl-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 117003940 |
| Molecular Formula | C13H8BrNO3S |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 336.94 |
| IUPAC Name | 4-bromo-1,1-dioxo-2-phenyl-1,2-benzothiazol-3-one |
| SMILES | O=C1c2c(Br)cccc2S(=O)(=O)N1c1ccccc1 |
| InChI | InChI=1S/C13H8BrNO3S/c14-10-7-4-8-11-12(10)13(16)15(19(11,17)18)9-5-2-1-3-6-9/h1-8H |
| InChIKey | JHBLNIFFRLROGT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |