About 1,6-dibromo-10,10-dioxothioxanthen-9-one
1,6-dibromo-10,10-dioxothioxanthen-9-one (PubChem CID 135133754) has the molecular formula C13H6Br2O3S
and a molecular weight of 402.06 g/mol. Its IUPAC name is 1,6-dibromo-10,10-dioxothioxanthen-9-one.
Molecular Properties
| Compound Name | 1,6-dibromo-10,10-dioxothioxanthen-9-one |
| PubChem CID | 135133754 |
| Molecular Formula | C13H6Br2O3S |
| Molecular Weight | 402.06 g/mol |
| Exact Mass | 399.84 |
| IUPAC Name | 1,6-dibromo-10,10-dioxothioxanthen-9-one |
| SMILES | O=C1c2ccc(Br)cc2S(=O)(=O)c2cccc(Br)c21 |
| InChI | InChI=1S/C13H6Br2O3S/c14-7-4-5-8-11(6-7)19(17,18)10-3-1-2-9(15)12(10)13(8)16/h1-6H |
| InChIKey | VFEHWRJQKQOLBG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.06 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,6-dibromo-10,10-dioxothioxanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dibromo-10,10-dioxothioxanthen-9-one?
The IUPAC name of 1,6-dibromo-10,10-dioxothioxanthen-9-one (CID 135133754) is 1,6-dibromo-10,10-dioxothioxanthen-9-one.
What is the SMILES notation for 1,6-dibromo-10,10-dioxothioxanthen-9-one?
The canonical SMILES for 1,6-dibromo-10,10-dioxothioxanthen-9-one is O=C1c2ccc(Br)cc2S(=O)(=O)c2cccc(Br)c21.
What is the InChIKey of 1,6-dibromo-10,10-dioxothioxanthen-9-one?
The InChIKey is VFEHWRJQKQOLBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6Br2O3S/c14-7-4-5-8-11(6-7)19(17,18)10-3-1-2-9(15)12(10)13(8)16/h1-6H.
What are the key properties of 1,6-dibromo-10,10-dioxothioxanthen-9-one?
1,6-dibromo-10,10-dioxothioxanthen-9-one has a molecular weight of 402.06 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dibromo-10,10-dioxothioxanthen-9-one is sourced from PubChem (CID 135133754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).